C20H17BrN2O4 — CID 171092239
7-bromo-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;ethane (PubChem CID 171092239) has the molecular formula C20H17BrN2O4 and a molecular weight of 429.27 g/mol. Its IUPAC name is 7-bromo-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;ethane.
| Compound Name | 7-bromo-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;ethane |
|---|---|
| PubChem CID | 171092239 |
| Molecular Formula | C20H17BrN2O4 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 7-bromo-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;ethane |
| SMILES | CC.O=C1OCc2c(cc3n(c2=O)Cc2cc4cc(Br)ccc4nc2-3)C1O |
| InChI | InChI=1S/C18H11BrN2O4.C2H6/c19-10-1-2-13-8(4-10)3-9-6-21-14(15(9)20-13)5-11-12(17(21)23)7-25-18(24)16(11)22;1-2/h1-5,16,22H,6-7H2;1-2H3 |
| InChIKey | ZZFSRYQLCYUZCV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |