C17H11N3O5 — CID 163915061
(19S)-19-hydroxy-17-oxa-3,7,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,10,15(20)-hexaene-8,14,18-trione (PubChem CID 163915061) has the molecular formula C17H11N3O5 and a molecular weight of 337.29 g/mol. Its IUPAC name is (19S)-19-hydroxy-17-oxa-3,7,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,10,15(20)-hexaene-8,14,18-trione.
| Compound Name | (19S)-19-hydroxy-17-oxa-3,7,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,10,15(20)-hexaene-8,14,18-trione |
|---|---|
| PubChem CID | 163915061 |
| Molecular Formula | C17H11N3O5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (19S)-19-hydroxy-17-oxa-3,7,13-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,10,15(20)-hexaene-8,14,18-trione |
| SMILES | O=C1OCc2c(cc3n(c2=O)Cc2cc4c(=O)[nH]ccc4nc2-3)[C@@H]1O |
| InChI | InChI=1S/C17H11N3O5/c21-14-8-4-12-13-7(3-9-11(19-13)1-2-18-15(9)22)5-20(12)16(23)10(8)6-25-17(14)24/h1-4,14,21H,5-6H2,(H,18,22)/t14-/m0/s1 |
| InChIKey | QVMRRMOURKGIHB-AWEZNQCLSA-N |
| XLogP | 0.20 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |