C36H41N5O5 — CID 176554610
7,19-dihydroxy-8-[[4-[6-(N-methylanilino)hexyl]piperazin-1-yl]methyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 176554610) has the molecular formula C36H41N5O5 and a molecular weight of 623.75 g/mol. Its IUPAC name is 7,19-dihydroxy-8-[[4-[6-(N-methylanilino)hexyl]piperazin-1-yl]methyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 7,19-dihydroxy-8-[[4-[6-(N-methylanilino)hexyl]piperazin-1-yl]methyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 176554610 |
| Molecular Formula | C36H41N5O5 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 7,19-dihydroxy-8-[[4-[6-(N-methylanilino)hexyl]piperazin-1-yl]methyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CN(CCCCCCN1CCN(Cc2c(O)ccc3nc4c(cc23)Cn2c-4cc3c(c2=O)COC(=O)C3O)CC1)c1ccccc1 |
| InChI | InChI=1S/C36H41N5O5/c1-38(25-9-5-4-6-10-25)13-7-2-3-8-14-39-15-17-40(18-16-39)22-28-26-19-24-21-41-31(33(24)37-30(26)11-12-32(28)42)20-27-29(35(41)44)23-46-36(45)34(27)43/h4-6,9-12,19-20,34,42-43H,2-3,7-8,13-18,21-23H2,1H3 |
| InChIKey | DRLYDUQQXCTPMP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|