C35H42N3O5P — CID 167178896
2-[4-[amino-(2,4-dimethoxyphenyl)methyl]phenoxy]-N-[6-(diphenylphosphorylamino)hexan-2-yl]acetamide (PubChem CID 167178896) has the molecular formula C35H42N3O5P and a molecular weight of 615.71 g/mol. Its IUPAC name is 2-[4-[amino-(2,4-dimethoxyphenyl)methyl]phenoxy]-N-[6-(diphenylphosphorylamino)hexan-2-yl]acetamide.
| Compound Name | 2-[4-[amino-(2,4-dimethoxyphenyl)methyl]phenoxy]-N-[6-(diphenylphosphorylamino)hexan-2-yl]acetamide |
|---|---|
| PubChem CID | 167178896 |
| Molecular Formula | C35H42N3O5P |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 2-[4-[amino-(2,4-dimethoxyphenyl)methyl]phenoxy]-N-[6-(diphenylphosphorylamino)hexan-2-yl]acetamide |
| SMILES | COc1ccc(C(N)c2ccc(OCC(=O)NC(C)CCCCNP(=O)(c3ccccc3)c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C35H42N3O5P/c1-26(12-10-11-23-37-44(40,30-13-6-4-7-14-30)31-15-8-5-9-16-31)38-34(39)25-43-28-19-17-27(18-20-28)35(36)32-22-21-29(41-2)24-33(32)42-3/h4-9,13-22,24,26,35H,10-12,23,25,36H2,1-3H3,(H,37,40)(H,38,39) |
| InChIKey | HNXFBXVGTUIPLG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|