C25H25FN6O2 — CID 167179043
5-[(2R)-4-[(8-fluoro-6-oxo-5H-benzo[c][1,5]naphthyridin-3-yl)methyl]-2-methylpiperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 167179043) has the molecular formula C25H25FN6O2 and a molecular weight of 460.51 g/mol. Its IUPAC name is 5-[(2R)-4-[(8-fluoro-6-oxo-5H-benzo[c][1,5]naphthyridin-3-yl)methyl]-2-methylpiperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[(2R)-4-[(8-fluoro-6-oxo-5H-benzo[c][1,5]naphthyridin-3-yl)methyl]-2-methylpiperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 167179043 |
| Molecular Formula | C25H25FN6O2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 5-[(2R)-4-[(8-fluoro-6-oxo-5H-benzo[c][1,5]naphthyridin-3-yl)methyl]-2-methylpiperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3cnc4c(c3)[nH]c(=O)c3cc(F)ccc34)C[C@H]2C)cn1 |
| InChI | InChI=1S/C25H25FN6O2/c1-15-13-31(7-8-32(15)18-4-6-21(28-12-18)25(34)27-2)14-16-9-22-23(29-11-16)19-5-3-17(26)10-20(19)24(33)30-22/h3-6,9-12,15H,7-8,13-14H2,1-2H3,(H,27,34)(H,30,33)/t15-/m1/s1 |
| InChIKey | GOJPLXKKOPNYDP-OAHLLOKOSA-N |
| XLogP | 2.68 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|