C13H9FN2O2 — CID 167179091
8-fluoro-3-(hydroxymethyl)-5H-benzo[c][1,5]naphthyridin-6-one (PubChem CID 167179091) has the molecular formula C13H9FN2O2 and a molecular weight of 244.22 g/mol. Its IUPAC name is 8-fluoro-3-(hydroxymethyl)-5H-benzo[c][1,5]naphthyridin-6-one.
| Compound Name | 8-fluoro-3-(hydroxymethyl)-5H-benzo[c][1,5]naphthyridin-6-one |
|---|---|
| PubChem CID | 167179091 |
| Molecular Formula | C13H9FN2O2 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 8-fluoro-3-(hydroxymethyl)-5H-benzo[c][1,5]naphthyridin-6-one |
| SMILES | O=c1[nH]c2cc(CO)cnc2c2ccc(F)cc12 |
| InChI | InChI=1S/C13H9FN2O2/c14-8-1-2-9-10(4-8)13(18)16-11-3-7(6-17)5-15-12(9)11/h1-5,17H,6H2,(H,16,18) |
| InChIKey | CCSDQABQOHUELL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|