C22H25FN3O6P — CID 90956606
ethoxy-[3-[[7-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)-2-oxo-1H-1,5-naphthyridine-3-carbonyl]amino]propyl]phosphinic acid (PubChem CID 90956606) has the molecular formula C22H25FN3O6P and a molecular weight of 477.43 g/mol. Its IUPAC name is ethoxy-[3-[[7-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)-2-oxo-1H-1,5-naphthyridine-3-carbonyl]amino]propyl]phosphinic acid.
| Compound Name | ethoxy-[3-[[7-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)-2-oxo-1H-1,5-naphthyridine-3-carbonyl]amino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 90956606 |
| Molecular Formula | C22H25FN3O6P |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | ethoxy-[3-[[7-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)-2-oxo-1H-1,5-naphthyridine-3-carbonyl]amino]propyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CCCNC(=O)c1c(CO)c2ncc(Cc3ccc(F)cc3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H25FN3O6P/c1-2-32-33(30,31)9-3-8-24-21(28)19-17(13-27)20-18(26-22(19)29)11-15(12-25-20)10-14-4-6-16(23)7-5-14/h4-7,11-12,27H,2-3,8-10,13H2,1H3,(H,24,28)(H,26,29)(H,30,31) |
| InChIKey | PKIZYVFVHPWHBH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|