C12H18N4O2 — CID 167179178
5-[3-(hydroxymethyl)piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 167179178) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-[3-(hydroxymethyl)piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[3-(hydroxymethyl)piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 167179178 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-[3-(hydroxymethyl)piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCNC(CO)C2)cn1 |
| InChI | InChI=1S/C12H18N4O2/c1-13-12(18)11-3-2-10(6-15-11)16-5-4-14-9(7-16)8-17/h2-3,6,9,14,17H,4-5,7-8H2,1H3,(H,13,18) |
| InChIKey | WJVSYMJDNGRVET-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |