C18H29FN4O — CID 169149204
5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 169149204) has the molecular formula C18H29FN4O and a molecular weight of 336.46 g/mol. Its IUPAC name is 5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169149204 |
| Molecular Formula | C18H29FN4O |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CCC(F)CCN(C)C1CCN(c2ccc(C(=O)NC)nc2)CC1 |
| InChI | InChI=1S/C18H29FN4O/c1-4-14(19)7-10-22(3)15-8-11-23(12-9-15)16-5-6-17(21-13-16)18(24)20-2/h5-6,13-15H,4,7-12H2,1-3H3,(H,20,24) |
| InChIKey | HFLPSIRZFKZLHU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |