C22H41FN4O — CID 169149242
ethane;5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 169149242) has the molecular formula C22H41FN4O and a molecular weight of 396.60 g/mol. Its IUPAC name is ethane;5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | ethane;5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169149242 |
| Molecular Formula | C22H41FN4O |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.33 |
| IUPAC Name | ethane;5-[4-[3-fluoropentyl(methyl)amino]piperidin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CC.CC.CCC(F)CCN(C)C1CCN(c2ccc(C(=O)NC)nc2)CC1 |
| InChI | InChI=1S/C18H29FN4O.2C2H6/c1-4-14(19)7-10-22(3)15-8-11-23(12-9-15)16-5-6-17(21-13-16)18(24)20-2;2*1-2/h5-6,13-15H,4,7-12H2,1-3H3,(H,20,24);2*1-2H3 |
| InChIKey | JIMLIHPXPDMQJN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |