C17H26N2 — CID 167179416
4-[(4Z)-4-[(Z)-but-2-enylidene]-5-methylidene-1-propylpyrrol-3-yl]piperidine (PubChem CID 167179416) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 4-[(4Z)-4-[(Z)-but-2-enylidene]-5-methylidene-1-propylpyrrol-3-yl]piperidine.
| Compound Name | 4-[(4Z)-4-[(Z)-but-2-enylidene]-5-methylidene-1-propylpyrrol-3-yl]piperidine |
|---|---|
| PubChem CID | 167179416 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 4-[(4Z)-4-[(Z)-but-2-enylidene]-5-methylidene-1-propylpyrrol-3-yl]piperidine |
| SMILES | C=c1/c(=C\C=C/C)c(C2CCNCC2)cn1CCC |
| InChI | InChI=1S/C17H26N2/c1-4-6-7-16-14(3)19(12-5-2)13-17(16)15-8-10-18-11-9-15/h4,6-7,13,15,18H,3,5,8-12H2,1-2H3/b6-4-,16-7+ |
| InChIKey | CFCOHDOXSXSMRK-LRPNAGJPSA-N |
| XLogP | 2.13 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |