C21H29BrO9 — CID 167179504
2-(3-bromo-2-hydroxypropanoyl)oxyethyl 4-oxo-4-(2,4,5-triethoxyphenyl)butanoate (PubChem CID 167179504) has the molecular formula C21H29BrO9 and a molecular weight of 505.36 g/mol. Its IUPAC name is 2-(3-bromo-2-hydroxypropanoyl)oxyethyl 4-oxo-4-(2,4,5-triethoxyphenyl)butanoate.
| Compound Name | 2-(3-bromo-2-hydroxypropanoyl)oxyethyl 4-oxo-4-(2,4,5-triethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 167179504 |
| Molecular Formula | C21H29BrO9 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-(3-bromo-2-hydroxypropanoyl)oxyethyl 4-oxo-4-(2,4,5-triethoxyphenyl)butanoate |
| SMILES | CCOc1cc(OCC)c(C(=O)CCC(=O)OCCOC(=O)C(O)CBr)cc1OCC |
| InChI | InChI=1S/C21H29BrO9/c1-4-27-17-12-19(29-6-3)18(28-5-2)11-14(17)15(23)7-8-20(25)30-9-10-31-21(26)16(24)13-22/h11-12,16,24H,4-10,13H2,1-3H3 |
| InChIKey | QCBSOQOGPJOVJJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|