C17H26O6 — CID 166142099
formic acid;1-(2,4,5-triethoxyphenyl)butan-1-one (PubChem CID 166142099) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is formic acid;1-(2,4,5-triethoxyphenyl)butan-1-one.
| Compound Name | formic acid;1-(2,4,5-triethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 166142099 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | formic acid;1-(2,4,5-triethoxyphenyl)butan-1-one |
| SMILES | CCCC(=O)c1cc(OCC)c(OCC)cc1OCC.O=CO |
| InChI | InChI=1S/C16H24O4.CH2O2/c1-5-9-13(17)12-10-15(19-7-3)16(20-8-4)11-14(12)18-6-2;2-1-3/h10-11H,5-9H2,1-4H3;1H,(H,2,3) |
| InChIKey | OEOPSLPEPRPJAU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|