C21H25NO4 — CID 46210565
4-(4,5-diethoxy-2-methylphenyl)-4-oxo-N-phenylbutanamide (PubChem CID 46210565) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-(4,5-diethoxy-2-methylphenyl)-4-oxo-N-phenylbutanamide.
| Compound Name | 4-(4,5-diethoxy-2-methylphenyl)-4-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 46210565 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-(4,5-diethoxy-2-methylphenyl)-4-oxo-N-phenylbutanamide |
| SMILES | CCOc1cc(C)c(C(=O)CCC(=O)Nc2ccccc2)cc1OCC |
| InChI | InChI=1S/C21H25NO4/c1-4-25-19-13-15(3)17(14-20(19)26-5-2)18(23)11-12-21(24)22-16-9-7-6-8-10-16/h6-10,13-14H,4-5,11-12H2,1-3H3,(H,22,24) |
| InChIKey | GSEHDTNGESXOTJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |