C28H30N2O4 — CID 154872547
4-(3,4-diethoxyphenyl)-N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-oxobutanamide (PubChem CID 154872547) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-(3,4-diethoxyphenyl)-N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-oxobutanamide.
| Compound Name | 4-(3,4-diethoxyphenyl)-N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 154872547 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 4-(3,4-diethoxyphenyl)-N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCc4ccccc43)cc2)cc1OCC |
| InChI | InChI=1S/C28H30N2O4/c1-3-33-26-15-9-21(19-27(26)34-4-2)25(31)14-16-28(32)29-22-10-12-23(13-11-22)30-18-17-20-7-5-6-8-24(20)30/h5-13,15,19H,3-4,14,16-18H2,1-2H3,(H,29,32) |
| InChIKey | KWYFHYVFRPYKJN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |