C22H21N3O3S — CID 56553200
N-[4-(2,3-dihydroindol-1-yl)phenyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56553200) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindol-1-yl)phenyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[4-(2,3-dihydroindol-1-yl)phenyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56553200 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[4-(2,3-dihydroindol-1-yl)phenyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)Nc2ccc(N3CCc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c23-29(27,28)20-11-5-16(6-12-20)15-22(26)24-18-7-9-19(10-8-18)25-14-13-17-3-1-2-4-21(17)25/h1-12H,13-15H2,(H,24,26)(H2,23,27,28) |
| InChIKey | NGVGLDGZQAFMJX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |