C26H27ClN4O4S — CID 16718744
3-[2-[4-[6-(4-chlorophenyl)-4-oxothieno[3,2-d]pyrimidin-3-yl]-2-methoxyphenoxy]ethyl]-1,1-diethylurea (PubChem CID 16718744) has the molecular formula C26H27ClN4O4S and a molecular weight of 527.05 g/mol. Its IUPAC name is 3-[2-[4-[6-(4-chlorophenyl)-4-oxothieno[3,2-d]pyrimidin-3-yl]-2-methoxyphenoxy]ethyl]-1,1-diethylurea.
| Compound Name | 3-[2-[4-[6-(4-chlorophenyl)-4-oxothieno[3,2-d]pyrimidin-3-yl]-2-methoxyphenoxy]ethyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 16718744 |
| Molecular Formula | C26H27ClN4O4S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 3-[2-[4-[6-(4-chlorophenyl)-4-oxothieno[3,2-d]pyrimidin-3-yl]-2-methoxyphenoxy]ethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCCOc1ccc(-n2cnc3cc(-c4ccc(Cl)cc4)sc3c2=O)cc1OC |
| InChI | InChI=1S/C26H27ClN4O4S/c1-4-30(5-2)26(33)28-12-13-35-21-11-10-19(14-22(21)34-3)31-16-29-20-15-23(36-24(20)25(31)32)17-6-8-18(27)9-7-17/h6-11,14-16H,4-5,12-13H2,1-3H3,(H,28,33) |
| InChIKey | XOAAIBFGRAVKSU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|