C24H24ClN3O3S — CID 58980805
6-(4-chlorophenyl)-3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 58980805) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(4-chlorophenyl)-3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 58980805 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 6-(4-chlorophenyl)-3-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1cc(-n2cnc3cc(-c4ccc(Cl)cc4)sc3c2=O)ccc1OCCCN(C)C |
| InChI | InChI=1S/C24H24ClN3O3S/c1-27(2)11-4-12-31-20-10-9-18(13-21(20)30-3)28-15-26-19-14-22(32-23(19)24(28)29)16-5-7-17(25)8-6-16/h5-10,13-15H,4,11-12H2,1-3H3 |
| InChIKey | ZYIJYEBJRJFIAM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|