C22H20F3N3 — CID 167194459
N-cyclohexyl-5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 167194459) has the molecular formula C22H20F3N3 and a molecular weight of 383.42 g/mol. Its IUPAC name is N-cyclohexyl-5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-cyclohexyl-5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 167194459 |
| Molecular Formula | C22H20F3N3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-cyclohexyl-5-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | FC(F)(F)c1cccc(C#Cc2cnc3[nH]ccc3c2NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H20F3N3/c23-22(24,25)17-6-4-5-15(13-17)9-10-16-14-27-21-19(11-12-26-21)20(16)28-18-7-2-1-3-8-18/h4-6,11-14,18H,1-3,7-8H2,(H2,26,27,28) |
| InChIKey | CGRWQSOGFYDGCN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|