C17H24N2O3S — CID 167200416
(2Z)-N,2-dimethyl-N-[2-[(3-methylphenyl)methylsulfonylamino]ethyl]penta-2,4-dienamide (PubChem CID 167200416) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (2Z)-N,2-dimethyl-N-[2-[(3-methylphenyl)methylsulfonylamino]ethyl]penta-2,4-dienamide.
| Compound Name | (2Z)-N,2-dimethyl-N-[2-[(3-methylphenyl)methylsulfonylamino]ethyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 167200416 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2Z)-N,2-dimethyl-N-[2-[(3-methylphenyl)methylsulfonylamino]ethyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(/C)C(=O)N(C)CCNS(=O)(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C17H24N2O3S/c1-5-7-15(3)17(20)19(4)11-10-18-23(21,22)13-16-9-6-8-14(2)12-16/h5-9,12,18H,1,10-11,13H2,2-4H3/b15-7- |
| InChIKey | AVTOWSJBTYXZHV-CHHVJCJISA-N |
| XLogP | 2.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|