C22H15N7 — CID 167203057
2-(2-ethenyl-1H-indol-6-yl)-4-(1H-indazol-5-ylamino)pyrimidine-5-carbonitrile (PubChem CID 167203057) has the molecular formula C22H15N7 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-(2-ethenyl-1H-indol-6-yl)-4-(1H-indazol-5-ylamino)pyrimidine-5-carbonitrile.
| Compound Name | 2-(2-ethenyl-1H-indol-6-yl)-4-(1H-indazol-5-ylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 167203057 |
| Molecular Formula | C22H15N7 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(2-ethenyl-1H-indol-6-yl)-4-(1H-indazol-5-ylamino)pyrimidine-5-carbonitrile |
| SMILES | C=Cc1cc2ccc(-c3ncc(C#N)c(Nc4ccc5[nH]ncc5c4)n3)cc2[nH]1 |
| InChI | InChI=1S/C22H15N7/c1-2-17-7-13-3-4-14(9-20(13)26-17)21-24-11-16(10-23)22(28-21)27-18-5-6-19-15(8-18)12-25-29-19/h2-9,11-12,26H,1H2,(H,25,29)(H,24,27,28) |
| InChIKey | OWJVEKSPFSQPDK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |