C31H31F3N6O2 — CID 167204222
(4R,7R)-15-(2-amino-6-fluorophenyl)-14,16-difluoro-4,9-dimethyl-12-(4-methyl-2-propan-2-yl-3-pyridinyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione (PubChem CID 167204222) has the molecular formula C31H31F3N6O2 and a molecular weight of 576.62 g/mol. Its IUPAC name is (4R,7R)-15-(2-amino-6-fluorophenyl)-14,16-difluoro-4,9-dimethyl-12-(4-methyl-2-propan-2-yl-3-pyridinyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione.
| Compound Name | (4R,7R)-15-(2-amino-6-fluorophenyl)-14,16-difluoro-4,9-dimethyl-12-(4-methyl-2-propan-2-yl-3-pyridinyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione |
|---|---|
| PubChem CID | 167204222 |
| Molecular Formula | C31H31F3N6O2 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | (4R,7R)-15-(2-amino-6-fluorophenyl)-14,16-difluoro-4,9-dimethyl-12-(4-methyl-2-propan-2-yl-3-pyridinyl)-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)c2c(c3cc(F)c(-c4c(N)cccc4F)c(F)c31)N1C[C@@H](C)NC[C@@H]1C(=O)N2C |
| InChI | InChI=1S/C31H31F3N6O2/c1-14(2)25-26(15(3)9-10-36-25)40-27-17(11-19(33)23(24(27)34)22-18(32)7-6-8-20(22)35)28-29(31(40)42)38(5)30(41)21-12-37-16(4)13-39(21)28/h6-11,14,16,21,37H,12-13,35H2,1-5H3/t16-,21-/m1/s1 |
| InChIKey | HGNZNTKFYQMQKU-IIBYNOLFSA-N |
| XLogP | 4.63 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|