C14H15O3S- — CID 167206496
6-(2-methoxyphenyl)cyclohepta-1,6-diene-1-sulfinate (PubChem CID 167206496) has the molecular formula C14H15O3S- and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)cyclohepta-1,6-diene-1-sulfinate.
| Compound Name | 6-(2-methoxyphenyl)cyclohepta-1,6-diene-1-sulfinate |
|---|---|
| PubChem CID | 167206496 |
| Molecular Formula | C14H15O3S- |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 6-(2-methoxyphenyl)cyclohepta-1,6-diene-1-sulfinate |
| SMILES | COc1ccccc1C1=CC(S(=O)[O-])=CCCC1 |
| InChI | InChI=1S/C14H16O3S/c1-17-14-9-5-4-8-13(14)11-6-2-3-7-12(10-11)18(15)16/h4-5,7-10H,2-3,6H2,1H3,(H,15,16)/p-1 |
| InChIKey | QOWXKNQJYUJENQ-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|