C23H23IN7O3P — CID 167209468
1-[4-(hydroxymethyl)phenyl]-3-[4-(7-iodophosphanyl-6-morpholin-4-ylpurin-2-yl)phenyl]urea (PubChem CID 167209468) has the molecular formula C23H23IN7O3P and a molecular weight of 603.36 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)phenyl]-3-[4-(7-iodophosphanyl-6-morpholin-4-ylpurin-2-yl)phenyl]urea.
| Compound Name | 1-[4-(hydroxymethyl)phenyl]-3-[4-(7-iodophosphanyl-6-morpholin-4-ylpurin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 167209468 |
| Molecular Formula | C23H23IN7O3P |
| Molecular Weight | 603.36 g/mol |
| Exact Mass | 603.06 |
| IUPAC Name | 1-[4-(hydroxymethyl)phenyl]-3-[4-(7-iodophosphanyl-6-morpholin-4-ylpurin-2-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(CO)cc1)Nc1ccc(-c2nc(N3CCOCC3)c3c(ncn3PI)n2)cc1 |
| InChI | InChI=1S/C23H23IN7O3P/c24-35-31-14-25-21-19(31)22(30-9-11-34-12-10-30)29-20(28-21)16-3-7-18(8-4-16)27-23(33)26-17-5-1-15(13-32)2-6-17/h1-8,14,32,35H,9-13H2,(H2,26,27,33) |
| InChIKey | VDAWEVGWFWDBSA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|