C29H33F3N8O5 — CID 167209835
ethyl N-[5-[4-morpholin-4-yl-6-[[2-(4-oxohept-5-ynoylamino)ethylamino]methyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-4-(trifluoromethyl)-2-pyridinyl]carbamate (PubChem CID 167209835) has the molecular formula C29H33F3N8O5 and a molecular weight of 630.63 g/mol. Its IUPAC name is ethyl N-[5-[4-morpholin-4-yl-6-[[2-(4-oxohept-5-ynoylamino)ethylamino]methyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-4-(trifluoromethyl)-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-[4-morpholin-4-yl-6-[[2-(4-oxohept-5-ynoylamino)ethylamino]methyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-4-(trifluoromethyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 167209835 |
| Molecular Formula | C29H33F3N8O5 |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | ethyl N-[5-[4-morpholin-4-yl-6-[[2-(4-oxohept-5-ynoylamino)ethylamino]methyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-4-(trifluoromethyl)-2-pyridinyl]carbamate |
| SMILES | CC#CC(=O)CCC(=O)NCCNCc1cc2c(N3CCOCC3)nc(-c3cnc(NC(=O)OCC)cc3C(F)(F)F)nn2c1 |
| InChI | InChI=1S/C29H33F3N8O5/c1-3-5-20(41)6-7-25(42)34-9-8-33-16-19-14-23-27(39-10-12-44-13-11-39)37-26(38-40(23)18-19)21-17-35-24(36-28(43)45-4-2)15-22(21)29(30,31)32/h14-15,17-18,33H,4,6-13,16H2,1-2H3,(H,34,42)(H,35,36,43) |
| InChIKey | XWGOBPUVKRLSKV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|