C26H30N6O4 — CID 167209890
N-[2-[[2-(2-hydroxyphenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]methylamino]ethyl]-4-oxohept-5-ynamide (PubChem CID 167209890) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[2-[[2-(2-hydroxyphenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]methylamino]ethyl]-4-oxohept-5-ynamide.
| Compound Name | N-[2-[[2-(2-hydroxyphenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]methylamino]ethyl]-4-oxohept-5-ynamide |
|---|---|
| PubChem CID | 167209890 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-[2-[[2-(2-hydroxyphenyl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]methylamino]ethyl]-4-oxohept-5-ynamide |
| SMILES | CC#CC(=O)CCC(=O)NCCNCc1cc2c(N3CCOCC3)nc(-c3ccccc3O)nn2c1 |
| InChI | InChI=1S/C26H30N6O4/c1-2-5-20(33)8-9-24(35)28-11-10-27-17-19-16-22-26(31-12-14-36-15-13-31)29-25(30-32(22)18-19)21-6-3-4-7-23(21)34/h3-4,6-7,16,18,27,34H,8-15,17H2,1H3,(H,28,35) |
| InChIKey | GDIREMGBWYFNEI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|