C20H41N5O2 — CID 167209873
N-[2-(3-methylbutylamino)ethyl]-3-[4-[3-oxo-3-(propan-2-ylamino)propyl]piperazin-1-yl]propanamide (PubChem CID 167209873) has the molecular formula C20H41N5O2 and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[2-(3-methylbutylamino)ethyl]-3-[4-[3-oxo-3-(propan-2-ylamino)propyl]piperazin-1-yl]propanamide.
| Compound Name | N-[2-(3-methylbutylamino)ethyl]-3-[4-[3-oxo-3-(propan-2-ylamino)propyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 167209873 |
| Molecular Formula | C20H41N5O2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | N-[2-(3-methylbutylamino)ethyl]-3-[4-[3-oxo-3-(propan-2-ylamino)propyl]piperazin-1-yl]propanamide |
| SMILES | CC(C)CCNCCNC(=O)CCN1CCN(CCC(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C20H41N5O2/c1-17(2)5-8-21-9-10-22-19(26)6-11-24-13-15-25(16-14-24)12-7-20(27)23-18(3)4/h17-18,21H,5-16H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | XLMYHBKFJFJVCZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|