C26H51N5O2 — CID 167209945
3-[4-[3-[1-[3-[2-(3-methylbutylamino)ethylamino]-3-oxopropyl]piperidin-4-yl]propyl]piperidin-1-yl]propanamide (PubChem CID 167209945) has the molecular formula C26H51N5O2 and a molecular weight of 465.73 g/mol. Its IUPAC name is 3-[4-[3-[1-[3-[2-(3-methylbutylamino)ethylamino]-3-oxopropyl]piperidin-4-yl]propyl]piperidin-1-yl]propanamide.
| Compound Name | 3-[4-[3-[1-[3-[2-(3-methylbutylamino)ethylamino]-3-oxopropyl]piperidin-4-yl]propyl]piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 167209945 |
| Molecular Formula | C26H51N5O2 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.40 |
| IUPAC Name | 3-[4-[3-[1-[3-[2-(3-methylbutylamino)ethylamino]-3-oxopropyl]piperidin-4-yl]propyl]piperidin-1-yl]propanamide |
| SMILES | CC(C)CCNCCNC(=O)CCN1CCC(CCCC2CCN(CCC(N)=O)CC2)CC1 |
| InChI | InChI=1S/C26H51N5O2/c1-22(2)6-13-28-14-15-29-26(33)12-21-31-18-9-24(10-19-31)5-3-4-23-7-16-30(17-8-23)20-11-25(27)32/h22-24,28H,3-21H2,1-2H3,(H2,27,32)(H,29,33) |
| InChIKey | ZTUPWSVFOJRBTP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|