C19H36N2O2S2 — CID 167210152
(4R)-7-[(2R)-2-(2-methylpropanoyl)pyrrolidin-1-yl]-4-[(2-methylsulfanyl-1-sulfanylethyl)amino]octan-3-one (PubChem CID 167210152) has the molecular formula C19H36N2O2S2 and a molecular weight of 388.64 g/mol. Its IUPAC name is (4R)-7-[(2R)-2-(2-methylpropanoyl)pyrrolidin-1-yl]-4-[(2-methylsulfanyl-1-sulfanylethyl)amino]octan-3-one.
| Compound Name | (4R)-7-[(2R)-2-(2-methylpropanoyl)pyrrolidin-1-yl]-4-[(2-methylsulfanyl-1-sulfanylethyl)amino]octan-3-one |
|---|---|
| PubChem CID | 167210152 |
| Molecular Formula | C19H36N2O2S2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (4R)-7-[(2R)-2-(2-methylpropanoyl)pyrrolidin-1-yl]-4-[(2-methylsulfanyl-1-sulfanylethyl)amino]octan-3-one |
| SMILES | CCC(=O)[C@@H](CCC(C)N1CCC[C@@H]1C(=O)C(C)C)NC(S)CSC |
| InChI | InChI=1S/C19H36N2O2S2/c1-6-17(22)15(20-18(24)12-25-5)10-9-14(4)21-11-7-8-16(21)19(23)13(2)3/h13-16,18,20,24H,6-12H2,1-5H3/t14?,15-,16-,18?/m1/s1 |
| InChIKey | YCSKISISKMTLDZ-GARNVTTQSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|