C24H42N2O4 — CID 152958248
(E,4S,7S)-7-[[(2R)-1-butan-2-ylpiperidine-2-carbonyl]amino]-2,8-dimethyl-6-oxo-4-propan-2-ylnon-2-enoic acid (PubChem CID 152958248) has the molecular formula C24H42N2O4 and a molecular weight of 422.61 g/mol. Its IUPAC name is (E,4S,7S)-7-[[(2R)-1-butan-2-ylpiperidine-2-carbonyl]amino]-2,8-dimethyl-6-oxo-4-propan-2-ylnon-2-enoic acid.
| Compound Name | (E,4S,7S)-7-[[(2R)-1-butan-2-ylpiperidine-2-carbonyl]amino]-2,8-dimethyl-6-oxo-4-propan-2-ylnon-2-enoic acid |
|---|---|
| PubChem CID | 152958248 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | (E,4S,7S)-7-[[(2R)-1-butan-2-ylpiperidine-2-carbonyl]amino]-2,8-dimethyl-6-oxo-4-propan-2-ylnon-2-enoic acid |
| SMILES | CCC(C)N1CCCC[C@@H]1C(=O)N[C@H](C(=O)C[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C24H42N2O4/c1-8-18(7)26-12-10-9-11-20(26)23(28)25-22(16(4)5)21(27)14-19(15(2)3)13-17(6)24(29)30/h13,15-16,18-20,22H,8-12,14H2,1-7H3,(H,25,28)(H,29,30)/b17-13+/t18?,19-,20+,22-/m0/s1 |
| InChIKey | UQBFOIMHJNIOCV-WTMNOXJRSA-N |
| XLogP | 4.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|