C23H43N3O4 — CID 142814028
(E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2-methylbut-2-enoic acid;propane (PubChem CID 142814028) has the molecular formula C23H43N3O4 and a molecular weight of 425.61 g/mol. Its IUPAC name is (E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2-methylbut-2-enoic acid;propane.
| Compound Name | (E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2-methylbut-2-enoic acid;propane |
|---|---|
| PubChem CID | 142814028 |
| Molecular Formula | C23H43N3O4 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | (E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2-methylbut-2-enoic acid;propane |
| SMILES | CCC.CCC(C)N1CCCCC1C(=O)NC(C(=O)NC/C=C(\C)C(=O)O)C(C)C |
| InChI | InChI=1S/C20H35N3O4.C3H8/c1-6-15(5)23-12-8-7-9-16(23)18(24)22-17(13(2)3)19(25)21-11-10-14(4)20(26)27;1-3-2/h10,13,15-17H,6-9,11-12H2,1-5H3,(H,21,25)(H,22,24)(H,26,27);3H2,1-2H3/b14-10+; |
| InChIKey | DKYQCTMEPGUATP-KMZJGFRYSA-N |
| XLogP | 3.34 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|