C22H39N3O4 — CID 21031743
(E)-2,5-dimethyl-4-[[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoic acid (PubChem CID 21031743) has the molecular formula C22H39N3O4 and a molecular weight of 409.57 g/mol. Its IUPAC name is (E)-2,5-dimethyl-4-[[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoic acid.
| Compound Name | (E)-2,5-dimethyl-4-[[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoic acid |
|---|---|
| PubChem CID | 21031743 |
| Molecular Formula | C22H39N3O4 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | (E)-2,5-dimethyl-4-[[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoic acid |
| SMILES | C/C(=C\C(NC(=O)C(NC(=O)C1CCCCN1C(C)C)C(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C22H39N3O4/c1-13(2)17(12-16(7)22(28)29)23-21(27)19(14(3)4)24-20(26)18-10-8-9-11-25(18)15(5)6/h12-15,17-19H,8-11H2,1-7H3,(H,23,27)(H,24,26)(H,28,29)/b16-12+ |
| InChIKey | LALHEERAGOOARC-FOWTUZBSSA-N |
| XLogP | 2.56 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|