C23H41N3O4 — CID 21031673
(E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2,5-dimethylhex-2-enoic acid (PubChem CID 21031673) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 21031673 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (E)-4-[[2-[(1-butan-2-ylpiperidine-2-carbonyl)amino]-3-methylbutanoyl]amino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CCC(C)N1CCCCC1C(=O)NC(C(=O)NC(/C=C(\C)C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C23H41N3O4/c1-8-17(7)26-12-10-9-11-19(26)21(27)25-20(15(4)5)22(28)24-18(14(2)3)13-16(6)23(29)30/h13-15,17-20H,8-12H2,1-7H3,(H,24,28)(H,25,27)(H,29,30)/b16-13+ |
| InChIKey | WLVALEVFPDOLTM-DTQAZKPQSA-N |
| XLogP | 2.95 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|