C21H34IN5O3 — CID 167210218
tert-butyl N-[(4R)-8-[6-amino-3-(aminomethoxymethyl)-5-iodo-2-pyridinyl]-8-azaspiro[4.5]decan-4-yl]carbamate (PubChem CID 167210218) has the molecular formula C21H34IN5O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is tert-butyl N-[(4R)-8-[6-amino-3-(aminomethoxymethyl)-5-iodo-2-pyridinyl]-8-azaspiro[4.5]decan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-8-[6-amino-3-(aminomethoxymethyl)-5-iodo-2-pyridinyl]-8-azaspiro[4.5]decan-4-yl]carbamate |
|---|---|
| PubChem CID | 167210218 |
| Molecular Formula | C21H34IN5O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | tert-butyl N-[(4R)-8-[6-amino-3-(aminomethoxymethyl)-5-iodo-2-pyridinyl]-8-azaspiro[4.5]decan-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC12CCN(c1nc(N)c(I)cc1COCN)CC2 |
| InChI | InChI=1S/C21H34IN5O3/c1-20(2,3)30-19(28)25-16-5-4-6-21(16)7-9-27(10-8-21)18-14(12-29-13-23)11-15(22)17(24)26-18/h11,16H,4-10,12-13,23H2,1-3H3,(H2,24,26)(H,25,28)/t16-/m1/s1 |
| InChIKey | YQRUJRRXRLYPNF-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|