C42H78O5 — CID 167210266
[3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropyl] (Z)-16,16,18-trimethylicos-9-enoate (PubChem CID 167210266) has the molecular formula C42H78O5 and a molecular weight of 663.08 g/mol. Its IUPAC name is [3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropyl] (Z)-16,16,18-trimethylicos-9-enoate.
| Compound Name | [3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropyl] (Z)-16,16,18-trimethylicos-9-enoate |
|---|---|
| PubChem CID | 167210266 |
| Molecular Formula | C42H78O5 |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.58 |
| IUPAC Name | [3-[(Z)-hexadec-9-enoyl]oxy-2-hydroxypropyl] (Z)-16,16,18-trimethylicos-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCC(C)(C)CC(C)CC |
| InChI | InChI=1S/C42H78O5/c1-6-8-9-10-11-12-13-14-17-20-23-26-29-32-40(44)46-36-39(43)37-47-41(45)33-30-27-24-21-18-15-16-19-22-25-28-31-34-42(4,5)35-38(3)7-2/h12-13,16,19,38-39,43H,6-11,14-15,17-18,20-37H2,1-5H3/b13-12-,19-16- |
| InChIKey | ZFWNWCKPNSOFCI-AIUAJTKSSA-N |
| XLogP | 12.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|