C24H27ClF2N6O2 — CID 167211601
[1-[5-chloro-4-[(7-methyl-6-methylidene-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyrimidin-2-yl]-4,4-difluoropiperidin-3-yl]methanol (PubChem CID 167211601) has the molecular formula C24H27ClF2N6O2 and a molecular weight of 504.97 g/mol. Its IUPAC name is [1-[5-chloro-4-[(7-methyl-6-methylidene-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyrimidin-2-yl]-4,4-difluoropiperidin-3-yl]methanol.
| Compound Name | [1-[5-chloro-4-[(7-methyl-6-methylidene-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyrimidin-2-yl]-4,4-difluoropiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 167211601 |
| Molecular Formula | C24H27ClF2N6O2 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [1-[5-chloro-4-[(7-methyl-6-methylidene-1,2,3,4-tetrahydro-[1,4]oxazepino[2,3-c]quinolin-10-yl)amino]pyrimidin-2-yl]-4,4-difluoropiperidin-3-yl]methanol |
| SMILES | C=C1C2=C(NCCCO2)c2cc(Nc3nc(N4CCC(F)(F)C(CO)C4)ncc3Cl)ccc2N1C |
| InChI | InChI=1S/C24H27ClF2N6O2/c1-14-21-20(28-7-3-9-35-21)17-10-16(4-5-19(17)32(14)2)30-22-18(25)11-29-23(31-22)33-8-6-24(26,27)15(12-33)13-34/h4-5,10-11,15,28,34H,1,3,6-9,12-13H2,2H3,(H,29,30,31) |
| InChIKey | SFIBQQMVQQWAEM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |