C19H19N2O6P — CID 167213722
[7-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-oxochromen-4-yl]methylphosphonous acid (PubChem CID 167213722) has the molecular formula C19H19N2O6P and a molecular weight of 402.34 g/mol. Its IUPAC name is [7-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-oxochromen-4-yl]methylphosphonous acid.
| Compound Name | [7-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-oxochromen-4-yl]methylphosphonous acid |
|---|---|
| PubChem CID | 167213722 |
| Molecular Formula | C19H19N2O6P |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [7-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-oxochromen-4-yl]methylphosphonous acid |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)Nc1ccc2c(CP(O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H19N2O6P/c20-16(7-11-1-4-14(22)5-2-11)19(24)21-13-3-6-15-12(10-28(25)26)8-18(23)27-17(15)9-13/h1-6,8-9,16,22,25-26H,7,10,20H2,(H,21,24) |
| InChIKey | QEKRSDFDSKYSGA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 146.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|