C29H26F2N6O3S — CID 167217170
5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N,N-dimethyl-1,2-thiazole-3-carboxamide (PubChem CID 167217170) has the molecular formula C29H26F2N6O3S and a molecular weight of 576.63 g/mol. Its IUPAC name is 5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N,N-dimethyl-1,2-thiazole-3-carboxamide.
| Compound Name | 5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N,N-dimethyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 167217170 |
| Molecular Formula | C29H26F2N6O3S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N,N-dimethyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccn2c(-c3cc(C(=O)N(C)C)ns3)c(C3CCCC(=O)N3c3ccc(F)c(F)c3)nc2c1 |
| InChI | InChI=1S/C29H26F2N6O3S/c1-15-26(16(2)40-33-15)17-10-11-36-24(12-17)32-27(28(36)23-14-21(34-41-23)29(39)35(3)4)22-6-5-7-25(38)37(22)18-8-9-19(30)20(31)13-18/h8-14,22H,5-7H2,1-4H3 |
| InChIKey | NDGXUEQLDRDQRP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |