C27H22F2N6O4S — CID 167217423
2-[2-[(3R)-4-(3,4-difluorophenyl)-5-oxomorpholin-3-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,3-thiazole-5-carboxamide (PubChem CID 167217423) has the molecular formula C27H22F2N6O4S and a molecular weight of 564.57 g/mol. Its IUPAC name is 2-[2-[(3R)-4-(3,4-difluorophenyl)-5-oxomorpholin-3-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-[(3R)-4-(3,4-difluorophenyl)-5-oxomorpholin-3-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167217423 |
| Molecular Formula | C27H22F2N6O4S |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 2-[2-[(3R)-4-(3,4-difluorophenyl)-5-oxomorpholin-3-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1cnc(-c2c([C@@H]3COCC(=O)N3c3ccc(F)c(F)c3)nc3cc(-c4c(C)noc4C)ccn23)s1 |
| InChI | InChI=1S/C27H22F2N6O4S/c1-13-23(14(2)39-33-13)15-6-7-34-21(8-15)32-24(25(34)27-31-10-20(40-27)26(37)30-3)19-11-38-12-22(36)35(19)16-4-5-17(28)18(29)9-16/h4-10,19H,11-12H2,1-3H3,(H,30,37)/t19-/m0/s1 |
| InChIKey | NWXCYQHOZZERJV-IBGZPJMESA-N |
| XLogP | 4.47 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |