C15H14F2O2 — CID 167217978
4-[(2,3-difluoro-4-methylphenoxy)methyl]-3-methylphenol (PubChem CID 167217978) has the molecular formula C15H14F2O2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-[(2,3-difluoro-4-methylphenoxy)methyl]-3-methylphenol.
| Compound Name | 4-[(2,3-difluoro-4-methylphenoxy)methyl]-3-methylphenol |
|---|---|
| PubChem CID | 167217978 |
| Molecular Formula | C15H14F2O2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-[(2,3-difluoro-4-methylphenoxy)methyl]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1COc1ccc(C)c(F)c1F |
| InChI | InChI=1S/C15H14F2O2/c1-9-3-6-13(15(17)14(9)16)19-8-11-4-5-12(18)7-10(11)2/h3-7,18H,8H2,1-2H3 |
| InChIKey | ZYWXAVQGGSHHAZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |