C11H14ClN3O2 — CID 167220237
tert-butyl 3-chloro-1,2-dihydropyrrolo[2,3-c]pyridazine-7-carboxylate (PubChem CID 167220237) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is tert-butyl 3-chloro-1,2-dihydropyrrolo[2,3-c]pyridazine-7-carboxylate.
| Compound Name | tert-butyl 3-chloro-1,2-dihydropyrrolo[2,3-c]pyridazine-7-carboxylate |
|---|---|
| PubChem CID | 167220237 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | tert-butyl 3-chloro-1,2-dihydropyrrolo[2,3-c]pyridazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2c1NNC(Cl)=C2 |
| InChI | InChI=1S/C11H14ClN3O2/c1-11(2,3)17-10(16)15-5-4-7-6-8(12)13-14-9(7)15/h4-6,13-14H,1-3H3 |
| InChIKey | AYBJJSPNGUGAQK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|