C13H18F3N3O5S — CID 167221860
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(2-sulfanylethoxy)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221860) has the molecular formula C13H18F3N3O5S and a molecular weight of 385.36 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(2-sulfanylethoxy)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(2-sulfanylethoxy)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221860 |
| Molecular Formula | C13H18F3N3O5S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-(2-sulfanylethoxy)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@H](OCCS)[C@H](Nc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18F3N3O5S/c14-13(15,16)7-1-2-17-12(18-7)19-8-10(22)9(21)6(5-20)24-11(8)23-3-4-25/h1-2,6,8-11,20-22,25H,3-5H2,(H,17,18,19)/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | HIIFGJCJKPWRKD-ZHVGPZTNSA-N |
| XLogP | -0.34 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|