C22H20BrN4O4PS — CID 167222212
1-(4-bromo-2-methoxy-5-methylphenyl)-N-methylphosphanyl-2-oxo-N-pyrimidin-2-ylquinoline-6-sulfonamide (PubChem CID 167222212) has the molecular formula C22H20BrN4O4PS and a molecular weight of 547.37 g/mol. Its IUPAC name is 1-(4-bromo-2-methoxy-5-methylphenyl)-N-methylphosphanyl-2-oxo-N-pyrimidin-2-ylquinoline-6-sulfonamide.
| Compound Name | 1-(4-bromo-2-methoxy-5-methylphenyl)-N-methylphosphanyl-2-oxo-N-pyrimidin-2-ylquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 167222212 |
| Molecular Formula | C22H20BrN4O4PS |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | 1-(4-bromo-2-methoxy-5-methylphenyl)-N-methylphosphanyl-2-oxo-N-pyrimidin-2-ylquinoline-6-sulfonamide |
| SMILES | COc1cc(Br)c(C)cc1-n1c(=O)ccc2cc(S(=O)(=O)N(PC)c3ncccn3)ccc21 |
| InChI | InChI=1S/C22H20BrN4O4PS/c1-14-11-19(20(31-2)13-17(14)23)26-18-7-6-16(12-15(18)5-8-21(26)28)33(29,30)27(32-3)22-24-9-4-10-25-22/h4-13,32H,1-3H3 |
| InChIKey | HJLDDBVQLYPDJQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|