About 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine
3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (PubChem CID 167225284) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| PubChem CID | 167225284 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| SMILES | CC(C)N1CCn2c(cnc2-c2ccccc2)C1 |
| InChI | InChI=1S/C15H19N3/c1-12(2)17-8-9-18-14(11-17)10-16-15(18)13-6-4-3-5-7-13/h3-7,10,12H,8-9,11H2,1-2H3 |
| InChIKey | BUHMXQINGRWGMG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
The IUPAC name of 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (CID 167225284) is 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
What is the SMILES notation for 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
The canonical SMILES for 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine is CC(C)N1CCn2c(cnc2-c2ccccc2)C1.
What is the InChIKey of 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
The InChIKey is BUHMXQINGRWGMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-12(2)17-8-9-18-14(11-17)10-16-15(18)13-6-4-3-5-7-13/h3-7,10,12H,8-9,11H2,1-2H3.
What are the key properties of 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine has a molecular weight of 241.34 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine is sourced from PubChem (CID 167225284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).