C28H28N6O3 — CID 167225545
N-[3-[3-[1-[(3-aminopyrazin-2-yl)methoxymethylamino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]prop-2-ynyl]acetamide (PubChem CID 167225545) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-[3-[3-[1-[(3-aminopyrazin-2-yl)methoxymethylamino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]prop-2-ynyl]acetamide.
| Compound Name | N-[3-[3-[1-[(3-aminopyrazin-2-yl)methoxymethylamino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 167225545 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[3-[3-[1-[(3-aminopyrazin-2-yl)methoxymethylamino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]prop-2-ynyl]acetamide |
| SMILES | CC(=O)NCC#Cc1cccc2cc(C(C)NCOCc3nccnc3N)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C28H28N6O3/c1-19(33-18-37-17-24-27(29)32-15-14-31-24)25-16-22-9-6-8-21(10-7-13-30-20(2)35)26(22)28(36)34(25)23-11-4-3-5-12-23/h3-6,8-9,11-12,14-16,19,33H,13,17-18H2,1-2H3,(H2,29,32)(H,30,35) |
| InChIKey | TYCQVXIZTIGJRN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|