C6H8F2O — CID 167229197
3,5-difluorocyclohex-2-en-1-ol (PubChem CID 167229197) has the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. Its IUPAC name is 3,5-difluorocyclohex-2-en-1-ol.
| Compound Name | 3,5-difluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 167229197 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 3,5-difluorocyclohex-2-en-1-ol |
| SMILES | OC1C=C(F)CC(F)C1 |
| InChI | InChI=1S/C6H8F2O/c7-4-1-5(8)3-6(9)2-4/h2,5-6,9H,1,3H2 |
| InChIKey | GZBMHEGIBJZIGY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |