C15H20FN5O3 — CID 167231384
methyl N-[3-[[5-fluoro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]methoxy]propyl]carbamate (PubChem CID 167231384) has the molecular formula C15H20FN5O3 and a molecular weight of 337.36 g/mol. Its IUPAC name is methyl N-[3-[[5-fluoro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]methoxy]propyl]carbamate.
| Compound Name | methyl N-[3-[[5-fluoro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]methoxy]propyl]carbamate |
|---|---|
| PubChem CID | 167231384 |
| Molecular Formula | C15H20FN5O3 |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | methyl N-[3-[[5-fluoro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]methoxy]propyl]carbamate |
| SMILES | COC(=O)NCCCOCc1ccc(F)c(Nc2cc(C)[nH]n2)n1 |
| InChI | InChI=1S/C15H20FN5O3/c1-10-8-13(21-20-10)19-14-12(16)5-4-11(18-14)9-24-7-3-6-17-15(22)23-2/h4-5,8H,3,6-7,9H2,1-2H3,(H,17,22)(H2,18,19,20,21) |
| InChIKey | FLXBIELTEYCICF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|