C17H16BrClN5OP — CID 167231486
N-(5-bromo-2-chloropyrimidin-4-yl)-7-cyclopropyl-4-dimethylphosphoryl-1,8-naphthyridin-3-amine (PubChem CID 167231486) has the molecular formula C17H16BrClN5OP and a molecular weight of 452.68 g/mol. Its IUPAC name is N-(5-bromo-2-chloropyrimidin-4-yl)-7-cyclopropyl-4-dimethylphosphoryl-1,8-naphthyridin-3-amine.
| Compound Name | N-(5-bromo-2-chloropyrimidin-4-yl)-7-cyclopropyl-4-dimethylphosphoryl-1,8-naphthyridin-3-amine |
|---|---|
| PubChem CID | 167231486 |
| Molecular Formula | C17H16BrClN5OP |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | N-(5-bromo-2-chloropyrimidin-4-yl)-7-cyclopropyl-4-dimethylphosphoryl-1,8-naphthyridin-3-amine |
| SMILES | CP(C)(=O)c1c(Nc2nc(Cl)ncc2Br)cnc2nc(C3CC3)ccc12 |
| InChI | InChI=1S/C17H16BrClN5OP/c1-26(2,25)14-10-5-6-12(9-3-4-9)22-15(10)20-8-13(14)23-16-11(18)7-21-17(19)24-16/h5-9H,3-4H2,1-2H3,(H,21,23,24) |
| InChIKey | MXNPGJKEEORRFM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|