C34H41ClFN3O3 — CID 167232656
tert-butyl 6-chloro-7-ethyl-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(2-piperazin-1-ylethyl)indole-2-carboxylate (PubChem CID 167232656) has the molecular formula C34H41ClFN3O3 and a molecular weight of 594.17 g/mol. Its IUPAC name is tert-butyl 6-chloro-7-ethyl-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(2-piperazin-1-ylethyl)indole-2-carboxylate.
| Compound Name | tert-butyl 6-chloro-7-ethyl-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(2-piperazin-1-ylethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 167232656 |
| Molecular Formula | C34H41ClFN3O3 |
| Molecular Weight | 594.17 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | tert-butyl 6-chloro-7-ethyl-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1-(2-piperazin-1-ylethyl)indole-2-carboxylate |
| SMILES | CCc1c(Cl)ccc2c(CCCOc3cccc4cc(F)ccc34)c(C(=O)OC(C)(C)C)n(CCN3CCNCC3)c12 |
| InChI | InChI=1S/C34H41ClFN3O3/c1-5-25-29(35)14-13-28-27(9-7-21-41-30-10-6-8-23-22-24(36)11-12-26(23)30)32(33(40)42-34(2,3)4)39(31(25)28)20-19-38-17-15-37-16-18-38/h6,8,10-14,22,37H,5,7,9,15-21H2,1-4H3 |
| InChIKey | REVLDGHVYMHZAC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.17 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|