C11H12FNO2S — CID 167232888
N-(3-fluoro-4-sulfanylphenyl)-3-methyloxetane-3-carboxamide (PubChem CID 167232888) has the molecular formula C11H12FNO2S and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(3-fluoro-4-sulfanylphenyl)-3-methyloxetane-3-carboxamide.
| Compound Name | N-(3-fluoro-4-sulfanylphenyl)-3-methyloxetane-3-carboxamide |
|---|---|
| PubChem CID | 167232888 |
| Molecular Formula | C11H12FNO2S |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-(3-fluoro-4-sulfanylphenyl)-3-methyloxetane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(S)c(F)c2)COC1 |
| InChI | InChI=1S/C11H12FNO2S/c1-11(5-15-6-11)10(14)13-7-2-3-9(16)8(12)4-7/h2-4,16H,5-6H2,1H3,(H,13,14) |
| InChIKey | MVWRVBFMNYDQDJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|